Products 168026-81-1
CAS 168026-81-1 is the registry number for (±)14(15)-DiHETE. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5Z,8Z,11Z,14R,15R,17Z)-14,15-dihydroxyicosa-5,8,11,17-tetraenoic acid (CAS 168026-81-1) is a chemical compound with the molecular formula C20H32O4 and a molecular weight of 336.5 g/mol. IUPAC name: (5Z,8Z,11Z,14R,15R,17Z)-14,15-dihydroxyicosa-5,8,11,17-tetraenoic acid. InChIKey: BLWCDFIELVFRJY-YYXNPAPNSA-N.
| Molecular formula | C20H32O4 |
|---|---|
| Molecular weight | 336.5 g/mol |
| IUPAC name | (5Z,8Z,11Z,14R,15R,17Z)-14,15-dihydroxyicosa-5,8,11,17-tetraenoic acid |
| InChIKey | BLWCDFIELVFRJY-YYXNPAPNSA-N |
| SMILES | CC/C=C\C[C@H]([C@@H](C/C=C\C/C=C\C/C=C\CCCC(=O)O)O)O |
Computed by PubChem (NCBI)