Products 168077-38-1

CAS 168077-38-1 is the registry number for 2-(tert-Butoxycarbonylamino)-4-bromobutanoic acid methyl ester. Offered by: Biosynth. Available pack sizes: 0,1g, 0,05g, 0,25g, 0,5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 168077-38-1) is a chemical compound with the molecular formula C10H18BrNO4 and a molecular weight of 296.16 g/mol. IUPAC name: methyl 4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: MBWPBNACYMMIKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18BrNO4
Molecular weight296.16 g/mol
IUPAC namemethyl 4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate
InChIKeyMBWPBNACYMMIKZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CCBr)C(=O)OC

Computed by PubChem (NCBI)