Products 168082-74-4
CAS 168082-74-4 is the registry number for CGP 57698. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,2-diethyl-4-[3-[(7-fluoroquinolin-2-yl)methoxy]anilino]-4-oxobutanoic acid (CAS 168082-74-4) is a chemical compound with the molecular formula C24H25FN2O4 and a molecular weight of 424.5 g/mol. IUPAC name: 2,2-diethyl-4-[3-[(7-fluoroquinolin-2-yl)methoxy]anilino]-4-oxobutanoic acid. InChIKey: BFNAFTJCDGWFMQ-UHFFFAOYSA-N.
| Molecular formula | C24H25FN2O4 |
|---|---|
| Molecular weight | 424.5 g/mol |
| IUPAC name | 2,2-diethyl-4-[3-[(7-fluoroquinolin-2-yl)methoxy]anilino]-4-oxobutanoic acid |
| InChIKey | BFNAFTJCDGWFMQ-UHFFFAOYSA-N |
| SMILES | CCC(CC)(CC(=O)NC1=CC(=CC=C1)OCC2=NC3=C(C=CC(=C3)F)C=C2)C(=O)O |
Computed by PubChem (NCBI)