CAS 1681-60-3 appears in our catalog under these names: Acid Violet 3, Acid Violet 3, disodium 3-[(E)-2-(4-aminophenyl)diazen-1-yl]-4,5-dihydroxynaphthalene-2,7-disulfonate, 95%, 3-((4-Aminophenyl)diazenyl)-4,5-dihydroxynaphthalene-2,7-disulfonic acid, sodium salt, 95%, 95%. Offered by: GLPBio, Biosynth, TCI, Combi-blocks, Chemat. Available pack sizes: 5g, 100g, 10g, 25g, 50g, 250g, 1g, 100mg.
Disodium;3-[(4-aminophenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonate (CAS 1681-60-3) is a chemical compound with the molecular formula C16H11N3Na2O8S2 and a molecular weight of 483.4 g/mol. IUPAC name: disodium;3-[(4-aminophenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonate. InChIKey: BBWPEJUNPNPWJI-UHFFFAOYSA-L.
| Molecular formula | C16H11N3Na2O8S2 |
|---|---|
| Molecular weight | 483.4 g/mol |
| IUPAC name | disodium;3-[(4-aminophenyl)diazenyl]-4,5-dihydroxynaphthalene-2,7-disulfonate |
| InChIKey | BBWPEJUNPNPWJI-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC=C1N)N=NC2=C(C3=C(C=C(C=C3C=C2S(=O)(=O)[O-])S(=O)(=O)[O-])O)O.[Na+].[Na+] |
Computed by PubChem (NCBI)