CAS 168167-68-8 is the registry number for 1-(4-Bromophenyl)-2,2,3,3-tetrafluoropropan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromophenyl)-2,2,3,3-tetrafluoropropan-1-one (CAS 168167-68-8) is a chemical compound with the molecular formula C9H5BrF4O and a molecular weight of 285.03 g/mol. IUPAC name: 1-(4-bromophenyl)-2,2,3,3-tetrafluoropropan-1-one. InChIKey: DDIVPMWCORNPER-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF4O |
|---|---|
| Molecular weight | 285.03 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,2,3,3-tetrafluoropropan-1-one |
| InChIKey | DDIVPMWCORNPER-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(C(F)F)(F)F)Br |
Computed by PubChem (NCBI)