Products 1682660-39-4
CAS 1682660-39-4 appears in our catalog under these names: Des-4'(methylpiperidine-4-carboxamide)-4'-hydroxymethyl Revefenacin, >95% (HPLC), Revefenacin Impurity 16, Revefenacin Impurity 23, Revefenacin Impurity 3. Offered by: TRC, Chemat Brand, Hubei YoungXin. Available pack sizes: 0,5mg, 2,5mg, 5mg, on request, 10mg, 25mg, 50mg, 100mg.
[1-[2-[[4-(hydroxymethyl)benzoyl]-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (CAS 1682660-39-4) is a chemical compound with the molecular formula C29H33N3O4 and a molecular weight of 487.6 g/mol. IUPAC name: [1-[2-[[4-(hydroxymethyl)benzoyl]-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate. InChIKey: BDRTWFLPAGPESH-UHFFFAOYSA-N.
| Molecular formula | C29H33N3O4 |
|---|---|
| Molecular weight | 487.6 g/mol |
| IUPAC name | [1-[2-[[4-(hydroxymethyl)benzoyl]-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| InChIKey | BDRTWFLPAGPESH-UHFFFAOYSA-N |
| SMILES | CN(CCN1CCC(CC1)OC(=O)NC2=CC=CC=C2C3=CC=CC=C3)C(=O)C4=CC=C(C=C4)CO |
Computed by PubChem (NCBI)