Products 16827-42-2

CAS 16827-42-2 appears in our catalog under these names: 1,2-dihydro-Naphthoic Acid, 1,2-Dihydronaphthalene-1-carboxylic acid, 95%, 1,2-Dihydronaphthalene-1-carboxylic acid. Offered by: Chemat Brand, AmBeed, Biosynth. Available pack sizes: on request, 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1,2-dihydronaphthalene-1-carboxylic acid (CAS 16827-42-2) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: 1,2-dihydronaphthalene-1-carboxylic acid. InChIKey: XEKCTIFQAYFUSM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10O2
Molecular weight174.20 g/mol
IUPAC name1,2-dihydronaphthalene-1-carboxylic acid
InChIKeyXEKCTIFQAYFUSM-UHFFFAOYSA-N
SMILESC1C=CC2=CC=CC=C2C1C(=O)O

Computed by PubChem (NCBI)