CAS 168279-58-1 is the registry number for 3-(Methylthio)-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methylsulfanyl-4-oxo-6,7-dihydro-5H-2-benzothiophene-1-carboxylic acid (CAS 168279-58-1) is a chemical compound with the molecular formula C10H10O3S2 and a molecular weight of 242.3 g/mol. IUPAC name: 3-methylsulfanyl-4-oxo-6,7-dihydro-5H-2-benzothiophene-1-carboxylic acid. InChIKey: YUEPFPUBEDTMTC-UHFFFAOYSA-N.
| Molecular formula | C10H10O3S2 |
|---|---|
| Molecular weight | 242.3 g/mol |
| IUPAC name | 3-methylsulfanyl-4-oxo-6,7-dihydro-5H-2-benzothiophene-1-carboxylic acid |
| InChIKey | YUEPFPUBEDTMTC-UHFFFAOYSA-N |
| SMILES | CSC1=C2C(=C(S1)C(=O)O)CCCC2=O |
Computed by PubChem (NCBI)