CAS 168286-97-3 appears in our catalog under these names: 7-Hydroxy Coumarin 2,3,4-Tri-O-acetyl-Beta-D-glucuronide Methyl Ester, >95% (HPLC), 7-Hydroxy coumarin 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester. Offered by: TRC, Biosynth. Available pack sizes: 5mg, 2mg, 10mg, 50mg, 25mg.
Methyl (2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylate (CAS 168286-97-3) is a chemical compound with the molecular formula C22H22O12 and a molecular weight of 478.4 g/mol. IUPAC name: methyl (2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylate. InChIKey: GREJSCHGTQAQIT-YHZBMZHBSA-N.
| Molecular formula | C22H22O12 |
|---|---|
| Molecular weight | 478.4 g/mol |
| IUPAC name | methyl (2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylate |
| InChIKey | GREJSCHGTQAQIT-YHZBMZHBSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H]([C@@H](O[C@@H]([C@H]1OC(=O)C)OC2=CC3=C(C=C2)C=CC(=O)O3)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)