CAS 168286-98-4 appears in our catalog under these names: 7-Hydroxy Coumarin Glucuronide Sodium Salt, 7-Hydroxy Coumarin Beta-D-Glucuronide Sodium Salt, >95% (HPLC), 7-hydroxy Coumarin Glucuronide (sodium salt), 7–hydroxy Coumarin Glucuronide (sodium salt), 7-Hydroxycoumarin b-D-glucuronide sodium salt. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 1 mg, 5 mg, 10 mg.
Sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylate (CAS 168286-98-4) is a chemical compound with the molecular formula C15H13NaO9 and a molecular weight of 360.25 g/mol. IUPAC name: sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylate. InChIKey: SKHLGBDGEPDEME-KSOKONAESA-M.
| Molecular formula | C15H13NaO9 |
|---|---|
| Molecular weight | 360.25 g/mol |
| IUPAC name | sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylate |
| InChIKey | SKHLGBDGEPDEME-KSOKONAESA-M |
| SMILES | C1=CC(=CC2=C1C=CC(=O)O2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)[O-])O)O)O.[Na+] |
Computed by PubChem (NCBI)