Products 1683546-41-9
CAS 1683546-41-9 is the registry number for 5-Bromo-3-(trifluoromethyl)benzene-1,2-diol, ≥95%. Offered by: Chemat. Available pack sizes: 5g.
5-bromo-3-(trifluoromethyl)benzene-1,2-diol (CAS 1683546-41-9) is a chemical compound with the molecular formula C7H4BrF3O2 and a molecular weight of 257.00 g/mol. IUPAC name: 5-bromo-3-(trifluoromethyl)benzene-1,2-diol. InChIKey: XPAWJVPFPOANGE-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O2 |
|---|---|
| Molecular weight | 257.00 g/mol |
| IUPAC name | 5-bromo-3-(trifluoromethyl)benzene-1,2-diol |
| InChIKey | XPAWJVPFPOANGE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)O)O)Br |
Computed by PubChem (NCBI)