CAS 16839-98-8 appears in our catalog under these names: Atropine sulfate EP Impurity B, Atropine EP Impurity B, Noratropine discontinued see RM-A201602, Atropine EP Impurity B (Noratropine), Atropine Impurity 2(Atropine EP Impurity B). Offered by: Chemat Brand, Hubei YoungXin, Biosynth, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate (CAS 16839-98-8) is a chemical compound with the molecular formula C16H21NO3 and a molecular weight of 275.34 g/mol. IUPAC name: [(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate. InChIKey: ATKYNAZQGVYHIB-DGKWVBSXSA-N.
| Molecular formula | C16H21NO3 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | [(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate |
| InChIKey | ATKYNAZQGVYHIB-DGKWVBSXSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1N2)OC(=O)C(CO)C3=CC=CC=C3 |
Computed by PubChem (NCBI)