CAS 16844-27-2 appears in our catalog under these names: Lithium p-toluenesulfinate, 95%, Lithium p–toluenesulfinate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 25g, 5g.
Lithium 4-methylbenzenesulfinate (CAS 16844-27-2) is a chemical compound with the molecular formula C7H7LiO2S and a molecular weight of 162.2 g/mol. IUPAC name: lithium 4-methylbenzenesulfinate. InChIKey: MSUZXYWQEDRGFN-UHFFFAOYSA-M.
| Molecular formula | C7H7LiO2S |
|---|---|
| Molecular weight | 162.2 g/mol |
| IUPAC name | lithium 4-methylbenzenesulfinate |
| InChIKey | MSUZXYWQEDRGFN-UHFFFAOYSA-M |
| SMILES | [Li+].CC1=CC=C(C=C1)S(=O)[O-] |
Computed by PubChem (NCBI)