Products 1684452-85-4
CAS 1684452-85-4 appears in our catalog under these names: Mirabegron Impurity 15, Mirabegron Impurity 11. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(1R)-2-[2-(4-aminophenyl)ethylamino]-1-phenylethyl] 2-(2-amino-1,3-thiazol-4-yl)acetate (CAS 1684452-85-4) is a chemical compound with the molecular formula C21H24N4O2S and a molecular weight of 396.5 g/mol. IUPAC name: [(1R)-2-[2-(4-aminophenyl)ethylamino]-1-phenylethyl] 2-(2-amino-1,3-thiazol-4-yl)acetate. InChIKey: BGWDEAWXRWZTJQ-IBGZPJMESA-N.
| Molecular formula | C21H24N4O2S |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | [(1R)-2-[2-(4-aminophenyl)ethylamino]-1-phenylethyl] 2-(2-amino-1,3-thiazol-4-yl)acetate |
| InChIKey | BGWDEAWXRWZTJQ-IBGZPJMESA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CNCCC2=CC=C(C=C2)N)OC(=O)CC3=CSC(=N3)N |
Computed by PubChem (NCBI)