CAS 1685-97-8 appears in our catalog under these names: 2,2–Dibromo–1H–indene–1,3(2H)–dione, 2,2-Dibromo-1H-indene-1,3(2H)-dione, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2,2-dibromoindene-1,3-dione (CAS 1685-97-8) is a chemical compound with the molecular formula C9H4Br2O2 and a molecular weight of 303.93 g/mol. IUPAC name: 2,2-dibromoindene-1,3-dione. InChIKey: CQRUQZYEVHBSMD-UHFFFAOYSA-N.
| Molecular formula | C9H4Br2O2 |
|---|---|
| Molecular weight | 303.93 g/mol |
| IUPAC name | 2,2-dibromoindene-1,3-dione |
| InChIKey | CQRUQZYEVHBSMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2=O)(Br)Br |
Computed by PubChem (NCBI)