CAS 1685285-13-5 is the registry number for 2',5'-Difluoro-[1,1':4',1''-terphenyl]-4,4''-dicarbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(4-cyanophenyl)-2,5-difluorophenyl]benzonitrile (CAS 1685285-13-5) is a chemical compound with the molecular formula C20H10F2N2 and a molecular weight of 316.3 g/mol. IUPAC name: 4-[4-(4-cyanophenyl)-2,5-difluorophenyl]benzonitrile. InChIKey: SGPVRBSOMVYSER-UHFFFAOYSA-N.
| Molecular formula | C20H10F2N2 |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | 4-[4-(4-cyanophenyl)-2,5-difluorophenyl]benzonitrile |
| InChIKey | SGPVRBSOMVYSER-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC(=C(C=C2F)C3=CC=C(C=C3)C#N)F |
Computed by PubChem (NCBI)