CAS 2353500-56-6 appears in our catalog under these names: 3',5'-Difluoro-[1,1':4',1''-terphenyl]-2',6'-dicarbonitrile, 98%, 98%, 3',5'-Difluoro-[1,1':4',1''-terphenyl]-2',6'-dicarbonitrile, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,6-difluoro-2,5-diphenylbenzene-1,3-dicarbonitrile (CAS 2353500-56-6) is a chemical compound with the molecular formula C20H10F2N2 and a molecular weight of 316.3 g/mol. IUPAC name: 4,6-difluoro-2,5-diphenylbenzene-1,3-dicarbonitrile. InChIKey: VCAXLKSAPBGZPQ-UHFFFAOYSA-N.
| Molecular formula | C20H10F2N2 |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | 4,6-difluoro-2,5-diphenylbenzene-1,3-dicarbonitrile |
| InChIKey | VCAXLKSAPBGZPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=C(C(=C2C#N)F)C3=CC=CC=C3)F)C#N |
Computed by PubChem (NCBI)