CAS 168555-66-6 appears in our catalog under these names: Combretastatin A4 Phosphate Disodium Salt, Fosbretabulin (Combretastatin A4 Phosphate (CA4P)) Disodium, Fosbretabulin Disodium/ 99.96% (existing batch purity), Combretastatin A4 Phosphate Disodium Salt, >98.0%(HPLC), Fosbretabulin disodium 98%. Offered by: TRC, GLPBio, TargetMol, TCI, Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 1mg, 2mg, 5mg, 100mg.
Disodium;[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate (CAS 168555-66-6) is a chemical compound with the molecular formula C18H19Na2O8P and a molecular weight of 440.3 g/mol. IUPAC name: disodium;[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate. InChIKey: VXNQMUVMEIGUJW-XNOMRPDFSA-L.
| Molecular formula | C18H19Na2O8P |
|---|---|
| Molecular weight | 440.3 g/mol |
| IUPAC name | disodium;[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate |
| InChIKey | VXNQMUVMEIGUJW-XNOMRPDFSA-L |
| SMILES | COC1=C(C=C(C=C1)/C=C\C2=CC(=C(C(=C2)OC)OC)OC)OP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)