Products 16856-18-1

CAS 16856-18-1 appears in our catalog under these names: L-Arginine a-ketoglutarate (1:1), (S)-2-Amino-5-guanidinopentanoic acid 2-oxopentanedioic acid (1:1), 98%, (S)-2-Amino-5-guanidinopentanoic acid compound with 2-oxopentanedioic acid (1:1), 98%, 98%, L-Arginine alpha-ketoglutarate, 95%, H-Arg-OH α-ketoglutarate 98%. Offered by: Biosynth, Fluorochem, Chemat, Combi-blocks, Ambeed. Available pack sizes: 25g, 10g, 50g, 100g, 500g, 5g, 1g, 1000g.

Structural formula: {0} (CAS {1})

(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-oxopentanedioic acid (CAS 16856-18-1) is a chemical compound with the molecular formula C11H20N4O7 and a molecular weight of 320.30 g/mol. IUPAC name: (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-oxopentanedioic acid. InChIKey: PGRNZHOQVAPMFX-WCCKRBBISA-N.

Identity
Molecular formulaC11H20N4O7
Molecular weight320.30 g/mol
IUPAC name(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-oxopentanedioic acid
InChIKeyPGRNZHOQVAPMFX-WCCKRBBISA-N
SMILESC(C[C@@H](C(=O)O)N)CN=C(N)N.C(CC(=O)O)C(=O)C(=O)O

Computed by PubChem (NCBI)