CAS 16856-28-3 appears in our catalog under these names: Z-Phe-trp-oh, 98%, Z–Phe–Trp–OH, Cbz-Phe-Trp-OH 97%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg.
(2S)-3-(1H-indol-3-yl)-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid (CAS 16856-28-3) is a chemical compound with the molecular formula C28H27N3O5 and a molecular weight of 485.5 g/mol. IUPAC name: (2S)-3-(1H-indol-3-yl)-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid. InChIKey: XPJAHPOAFDDPPF-DQEYMECFSA-N.
| Molecular formula | C28H27N3O5 |
|---|---|
| Molecular weight | 485.5 g/mol |
| IUPAC name | (2S)-3-(1H-indol-3-yl)-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
| InChIKey | XPJAHPOAFDDPPF-DQEYMECFSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N[C@@H](CC2=CNC3=CC=CC=C32)C(=O)O)NC(=O)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)