CAS 168567-91-7 is the registry number for 2,3,4-Tri-O-acetyl-1-azido-1-deoxy-b-D-arabinopyranosyl cyanide. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg.
[(3R,4R,5S,6S)-4,5-diacetyloxy-6-azido-6-cyanooxan-3-yl] acetate (CAS 168567-91-7) is a chemical compound with the molecular formula C12H14N4O7 and a molecular weight of 326.26 g/mol. IUPAC name: [(3R,4R,5S,6S)-4,5-diacetyloxy-6-azido-6-cyanooxan-3-yl] acetate. InChIKey: MNQOBHCPCLXJGP-WYUUTHIRSA-N.
| Molecular formula | C12H14N4O7 |
|---|---|
| Molecular weight | 326.26 g/mol |
| IUPAC name | [(3R,4R,5S,6S)-4,5-diacetyloxy-6-azido-6-cyanooxan-3-yl] acetate |
| InChIKey | MNQOBHCPCLXJGP-WYUUTHIRSA-N |
| SMILES | CC(=O)O[C@@H]1CO[C@]([C@H]([C@@H]1OC(=O)C)OC(=O)C)(C#N)N=[N+]=[N-] |
Computed by PubChem (NCBI)