CAS 16857-98-0 appears in our catalog under these names: 3,5-Bis(dimethylamino)phenol, 95%, 3,5-Bis(dimethylamino)phenol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3,5-bis(dimethylamino)phenol (CAS 16857-98-0) is a chemical compound with the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. IUPAC name: 3,5-bis(dimethylamino)phenol. InChIKey: VTBZONHGHSXYCH-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O |
|---|---|
| Molecular weight | 180.25 g/mol |
| IUPAC name | 3,5-bis(dimethylamino)phenol |
| InChIKey | VTBZONHGHSXYCH-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=CC(=C1)O)N(C)C |
Computed by PubChem (NCBI)