CAS 168682-53-9 appears in our catalog under these names: Ezatiostat, Ezatiostat/ 97.95% (existing batch purity), Ezatiostat 98%, Ezatiostat, 98%, 98%, Ezatiostat, 99.82%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
Ethyl (2S)-2-amino-5-[[(2R)-3-benzylsulfanyl-1-[[(1R)-2-ethoxy-2-oxo-1-phenylethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoate (CAS 168682-53-9) is a chemical compound with the molecular formula C27H35N3O6S and a molecular weight of 529.6 g/mol. IUPAC name: ethyl (2S)-2-amino-5-[[(2R)-3-benzylsulfanyl-1-[[(1R)-2-ethoxy-2-oxo-1-phenylethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoate. InChIKey: GWEJFLVSOGNLSS-WPFOTENUSA-N.
| Molecular formula | C27H35N3O6S |
|---|---|
| Molecular weight | 529.6 g/mol |
| IUPAC name | ethyl (2S)-2-amino-5-[[(2R)-3-benzylsulfanyl-1-[[(1R)-2-ethoxy-2-oxo-1-phenylethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoate |
| InChIKey | GWEJFLVSOGNLSS-WPFOTENUSA-N |
| SMILES | CCOC(=O)[C@H](CCC(=O)N[C@@H](CSCC1=CC=CC=C1)C(=O)N[C@H](C2=CC=CC=C2)C(=O)OCC)N |
Computed by PubChem (NCBI)