CAS 1687-36-1 is the registry number for 1,3,5,7-tetramethyladamantane. Offered by: Chemat Brand. Available pack sizes: on request.
1,3,5,7-tetramethyladamantane (CAS 1687-36-1) is a chemical compound with the molecular formula C14H24 and a molecular weight of 192.34 g/mol. IUPAC name: 1,3,5,7-tetramethyladamantane. InChIKey: UJSORZVCMMYGBS-UHFFFAOYSA-N.
| Molecular formula | C14H24 |
|---|---|
| Molecular weight | 192.34 g/mol |
| IUPAC name | 1,3,5,7-tetramethyladamantane |
| InChIKey | UJSORZVCMMYGBS-UHFFFAOYSA-N |
| SMILES | CC12CC3(CC(C1)(CC(C2)(C3)C)C)C |
Computed by PubChem (NCBI)