Products 16885-99-7

CAS 16885-99-7 is the registry number for 1-Propan-2-ylindole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

1-propan-2-ylindole (CAS 16885-99-7) is a chemical compound with the molecular formula C11H13N and a molecular weight of 159.23 g/mol. IUPAC name: 1-propan-2-ylindole. InChIKey: JDFIJVJKRTZYCK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13N
Molecular weight159.23 g/mol
IUPAC name1-propan-2-ylindole
InChIKeyJDFIJVJKRTZYCK-UHFFFAOYSA-N
SMILESCC(C)N1C=CC2=CC=CC=C21

Computed by PubChem (NCBI)