CAS 1688656-72-5 is the registry number for 1,1,4,4,6-Pentamethyl-7-(1-(p-tolyl)vinyl)-1,2,3,4-tetrahydronaphthalene, 98%. Offered by: AmBeed. Available pack sizes: 5g.
1,1,4,4,6-pentamethyl-7-[1-(4-methylphenyl)ethenyl]-2,3-dihydronaphthalene (CAS 1688656-72-5) is a chemical compound with the molecular formula C24H30 and a molecular weight of 318.5 g/mol. IUPAC name: 1,1,4,4,6-pentamethyl-7-[1-(4-methylphenyl)ethenyl]-2,3-dihydronaphthalene. InChIKey: IYCWQAAHRXLROL-UHFFFAOYSA-N.
| Molecular formula | C24H30 |
|---|---|
| Molecular weight | 318.5 g/mol |
| IUPAC name | 1,1,4,4,6-pentamethyl-7-[1-(4-methylphenyl)ethenyl]-2,3-dihydronaphthalene |
| InChIKey | IYCWQAAHRXLROL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=C)C2=CC3=C(C=C2C)C(CCC3(C)C)(C)C |
Computed by PubChem (NCBI)