CAS 1688666-59-2 appears in our catalog under these names: 2-Methoxy-5-trifluoromethoxyphenylboronic acid pinacol ester, 2-Methoxy-5-trifluoromethoxyphenylboronic acid pinacol ester, 95%, 2-Methoxy-5-trifluoromethoxyphenylboronic acid pinacol ester, 95%, 95%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 250mg, 5g.
2-[2-methoxy-5-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1688666-59-2) is a chemical compound with the molecular formula C14H18BF3O4 and a molecular weight of 318.10 g/mol. IUPAC name: 2-[2-methoxy-5-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OJOKFHNAZLXTJQ-UHFFFAOYSA-N.
| Molecular formula | C14H18BF3O4 |
|---|---|
| Molecular weight | 318.10 g/mol |
| IUPAC name | 2-[2-methoxy-5-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OJOKFHNAZLXTJQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)OC(F)(F)F)OC |
Computed by PubChem (NCBI)