CAS 16887-79-9 appears in our catalog under these names: Isonicotinic acid sodium salt, 98%, Sodium Isonicotinate, Sodium Isonicotinate, >99.0%(HPLC)(T), Sodium Isonicotinate 99%, Sodium Isonicotinate, 99%, 99%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100g, 5g, 25g, 250g, 500g, 1000g, 10g, 1kg.
Sodium pyridine-4-carboxylate (CAS 16887-79-9) is a chemical compound with the molecular formula C6H4NNaO2 and a molecular weight of 145.09 g/mol. IUPAC name: sodium pyridine-4-carboxylate. InChIKey: PVXCGWNPDFFPOV-UHFFFAOYSA-M.
| Molecular formula | C6H4NNaO2 |
|---|---|
| Molecular weight | 145.09 g/mol |
| IUPAC name | sodium pyridine-4-carboxylate |
| InChIKey | PVXCGWNPDFFPOV-UHFFFAOYSA-M |
| SMILES | C1=CN=CC=C1C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)