CAS 168922-04-1 is the registry number for Bis(2,2′:6′,2′′-terpyridine)ruthenium dichloride, 98%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Dichlororuthenium;bis(2,6-dipyridin-2-ylpyridine) (CAS 168922-04-1) is a chemical compound with the molecular formula C30H22Cl2N6Ru and a molecular weight of 638.5 g/mol. IUPAC name: dichlororuthenium;bis(2,6-dipyridin-2-ylpyridine). InChIKey: DGUNXPPILUFENH-UHFFFAOYSA-L.
| Molecular formula | C30H22Cl2N6Ru |
|---|---|
| Molecular weight | 638.5 g/mol |
| IUPAC name | dichlororuthenium;bis(2,6-dipyridin-2-ylpyridine) |
| InChIKey | DGUNXPPILUFENH-UHFFFAOYSA-L |
| SMILES | C1=CC=NC(=C1)C2=NC(=CC=C2)C3=CC=CC=N3.C1=CC=NC(=C1)C2=NC(=CC=C2)C3=CC=CC=N3.Cl[Ru]Cl |
Computed by PubChem (NCBI)