CAS 1690177-86-6 appears in our catalog under these names: Rel-(1r,3r)-3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid, 97%, cis-3-Hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid 95%, cis-3-Hydroxy-3-(trifluoromethyl)cyclobutanecarboxylic Acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 25g, 250mg, 100mg, 1g, 5g, 10g.
3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid (CAS 1690177-86-6) is a chemical compound with the molecular formula C6H7F3O3 and a molecular weight of 184.11 g/mol. IUPAC name: 3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid. InChIKey: PNVQKVUOLHLJTL-UHFFFAOYSA-N.
| Molecular formula | C6H7F3O3 |
|---|---|
| Molecular weight | 184.11 g/mol |
| IUPAC name | 3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid |
| InChIKey | PNVQKVUOLHLJTL-UHFFFAOYSA-N |
| SMILES | C1C(CC1(C(F)(F)F)O)C(=O)O |
Computed by PubChem (NCBI)