Products 1690425-34-3

CAS 1690425-34-3 is the registry number for 6-Thia-3-azabicyclo[3.2.1]octane 6,6-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6lambda6-thia-3-azabicyclo[3.2.1]octane 6,6-dioxide (CAS 1690425-34-3) is a chemical compound with the molecular formula C6H11NO2S and a molecular weight of 161.22 g/mol. IUPAC name: 6lambda6-thia-3-azabicyclo[3.2.1]octane 6,6-dioxide. InChIKey: QRYUKMLBZGGILM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11NO2S
Molecular weight161.22 g/mol
IUPAC name6lambda6-thia-3-azabicyclo[3.2.1]octane 6,6-dioxide
InChIKeyQRYUKMLBZGGILM-UHFFFAOYSA-N
SMILESC1C2CNCC1S(=O)(=O)C2

Computed by PubChem (NCBI)