Products 169044-98-8
CAS 169044-98-8 appears in our catalog under these names: 7-Aminoisoindolin-1-one, 98%, 98%, 7-Aminoisoindolin-1-one, 98%, 7-Aminoisoindolin-1-one 98%, 7–amino–2,3–dihydro–1H–isoindol–1–one, 7-Aminoisoindolin-1-one. Offered by: Chemat, Combi-blocks, Ambeed, Fluorochem, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 10g, 25g.
7-amino-2,3-dihydroisoindol-1-one (CAS 169044-98-8) is a chemical compound with the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. IUPAC name: 7-amino-2,3-dihydroisoindol-1-one. InChIKey: ZPJBSWJZELXZKA-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O |
|---|---|
| Molecular weight | 148.16 g/mol |
| IUPAC name | 7-amino-2,3-dihydroisoindol-1-one |
| InChIKey | ZPJBSWJZELXZKA-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)N)C(=O)N1 |
Computed by PubChem (NCBI)