CAS 1691057-24-5 is the registry number for 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3,6-dichlorobenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-dichloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 1691057-24-5) is a chemical compound with the molecular formula C22H15Cl2NO4 and a molecular weight of 428.3 g/mol. IUPAC name: 3,6-dichloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: YQPZLOKIDYWDEF-UHFFFAOYSA-N.
| Molecular formula | C22H15Cl2NO4 |
|---|---|
| Molecular weight | 428.3 g/mol |
| IUPAC name | 3,6-dichloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| InChIKey | YQPZLOKIDYWDEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=CC(=C4C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)