CAS 1691108-59-4 is the registry number for 1-(2,3-difluoro-4-methylphenyl)cyclohexanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,3-difluoro-4-methylphenyl)cyclohexan-1-ol (CAS 1691108-59-4) is a chemical compound with the molecular formula C13H16F2O and a molecular weight of 226.26 g/mol. IUPAC name: 1-(2,3-difluoro-4-methylphenyl)cyclohexan-1-ol. InChIKey: VLEMKGFFUZDBIF-UHFFFAOYSA-N.
| Molecular formula | C13H16F2O |
|---|---|
| Molecular weight | 226.26 g/mol |
| IUPAC name | 1-(2,3-difluoro-4-methylphenyl)cyclohexan-1-ol |
| InChIKey | VLEMKGFFUZDBIF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C2(CCCCC2)O)F)F |
Computed by PubChem (NCBI)