CAS 16919-31-6 is the registry number for Ammonium hexafluorozirconate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
Diazanium;hexafluorozirconium(2-) (CAS 16919-31-6) is a chemical compound with the molecular formula F6H8N2Zr and a molecular weight of 241.29 g/mol. IUPAC name: diazanium;hexafluorozirconium(2-). InChIKey: LPFRXGDQGULMEN-UHFFFAOYSA-J.
| Molecular formula | F6H8N2Zr |
|---|---|
| Molecular weight | 241.29 g/mol |
| IUPAC name | diazanium;hexafluorozirconium(2-) |
| InChIKey | LPFRXGDQGULMEN-UHFFFAOYSA-J |
| SMILES | [NH4+].[NH4+].F[Zr-2](F)(F)(F)(F)F |
Computed by PubChem (NCBI)