CAS 1692564-50-3 is the registry number for 2-Amino-4-(propane-2-sulfonyl)butanamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-4-propan-2-ylsulfonylbutanamide (CAS 1692564-50-3) is a chemical compound with the molecular formula C7H16N2O3S and a molecular weight of 208.28 g/mol. IUPAC name: 2-amino-4-propan-2-ylsulfonylbutanamide. InChIKey: ZSKUGIYWGOSVPY-UHFFFAOYSA-N.
| Molecular formula | C7H16N2O3S |
|---|---|
| Molecular weight | 208.28 g/mol |
| IUPAC name | 2-amino-4-propan-2-ylsulfonylbutanamide |
| InChIKey | ZSKUGIYWGOSVPY-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)CCC(C(=O)N)N |
Computed by PubChem (NCBI)