CAS 169293-32-7 is the registry number for (+)-Tianeptine Monosodium Salt. Offered by: TRC. Available pack sizes: 25mg.
Sodium 7-[(3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate (CAS 169293-32-7) is a chemical compound with the molecular formula C21H24ClN2NaO4S and a molecular weight of 458.9 g/mol. IUPAC name: sodium 7-[(3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate. InChIKey: ZLBSUOGMZDXYKE-UHFFFAOYSA-M.
| Molecular formula | C21H24ClN2NaO4S |
|---|---|
| Molecular weight | 458.9 g/mol |
| IUPAC name | sodium 7-[(3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate |
| InChIKey | ZLBSUOGMZDXYKE-UHFFFAOYSA-M |
| SMILES | CN1C2=CC=CC=C2C(C3=C(S1(=O)=O)C=C(C=C3)Cl)NCCCCCCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)