Products 169297-53-4
CAS 169297-53-4 appears in our catalog under these names: Epsilon-Caprolactam-d10, >95% (GC), epsilon-Caprolactam-d10, 98 atom % D, min 98% Chemical Purity, Ε-Caprolactam-d10, Azepan-2-one-d10, 99.8%. Offered by: TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 25mg, 0,1g, 0,05g, 250 mg, 5 mg, 25 mg.
3,3,4,4,5,5,6,6,7,7-decadeuterioazepan-2-one (CAS 169297-53-4) is a chemical compound with the molecular formula C6H11NO and a molecular weight of 123.22 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7-decadeuterioazepan-2-one. InChIKey: JBKVHLHDHHXQEQ-YXALHFAPSA-N.
| Molecular formula | C6H11NO |
|---|---|
| Molecular weight | 123.22 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7-decadeuterioazepan-2-one |
| InChIKey | JBKVHLHDHHXQEQ-YXALHFAPSA-N |
| SMILES | [2H]C1(C(=O)NC(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)