CAS 1693-66-9 appears in our catalog under these names: Formoterol Impurity 17, (+)-Paredrine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
4-[(2S)-2-aminopropyl]phenol (CAS 1693-66-9) is a chemical compound with the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. IUPAC name: 4-[(2S)-2-aminopropyl]phenol. InChIKey: GIKNHHRFLCDOEU-ZETCQYMHSA-N.
| Molecular formula | C9H13NO |
|---|---|
| Molecular weight | 151.21 g/mol |
| IUPAC name | 4-[(2S)-2-aminopropyl]phenol |
| InChIKey | GIKNHHRFLCDOEU-ZETCQYMHSA-N |
| SMILES | C[C@@H](CC1=CC=C(C=C1)O)N |
Computed by PubChem (NCBI)