CAS 16934-77-3 is the registry number for (1R,2R,5R)-2-Isopropyl-5-methylcyclohexanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexan-1-amine (CAS 16934-77-3) is a chemical compound with the molecular formula C10H21N and a molecular weight of 155.28 g/mol. IUPAC name: (1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexan-1-amine. InChIKey: RBMUAGDCCJDQLE-OPRDCNLKSA-N.
| Molecular formula | C10H21N |
|---|---|
| Molecular weight | 155.28 g/mol |
| IUPAC name | (1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexan-1-amine |
| InChIKey | RBMUAGDCCJDQLE-OPRDCNLKSA-N |
| SMILES | C[C@@H]1CC[C@@H]([C@@H](C1)N)C(C)C |
Computed by PubChem (NCBI)