CAS 1693646-20-6 is the registry number for 5-(4-Iodophenyl)isoxazole-3-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-iodophenyl)-1,2-oxazole-3-carboxylic acid (CAS 1693646-20-6) is a chemical compound with the molecular formula C10H6INO3 and a molecular weight of 315.06 g/mol. IUPAC name: 5-(4-iodophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: NXFRCFBOAXDXMQ-UHFFFAOYSA-N.
| Molecular formula | C10H6INO3 |
|---|---|
| Molecular weight | 315.06 g/mol |
| IUPAC name | 5-(4-iodophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | NXFRCFBOAXDXMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)C(=O)O)I |
Computed by PubChem (NCBI)