Products 169393-62-8
CAS 169393-62-8 is the registry number for Boc-L-Tyr(2,6-Cl2-Bzl)-ol. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g.
Tert-butyl N-[(2S)-1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-3-hydroxypropan-2-yl]carbamate (CAS 169393-62-8) is a chemical compound with the molecular formula C21H25Cl2NO4 and a molecular weight of 426.3 g/mol. IUPAC name: tert-butyl N-[(2S)-1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-3-hydroxypropan-2-yl]carbamate. InChIKey: NQVVUJZJBKATBB-HNNXBMFYSA-N.
| Molecular formula | C21H25Cl2NO4 |
|---|---|
| Molecular weight | 426.3 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-3-hydroxypropan-2-yl]carbamate |
| InChIKey | NQVVUJZJBKATBB-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)OCC2=C(C=CC=C2Cl)Cl)CO |
Computed by PubChem (NCBI)