Products 169397-96-0
CAS 169397-96-0 appears in our catalog under these names: 1,6-Dibromohexane-d12, 98 atom % D, min 98% Chemical Purity, 1,6-Dibromo-n-hexane-d12. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
1,6-dibromo-1,1,2,2,3,3,4,4,5,5,6,6-dodecadeuteriohexane (CAS 169397-96-0) is a chemical compound with the molecular formula C6H12Br2 and a molecular weight of 256.04 g/mol. IUPAC name: 1,6-dibromo-1,1,2,2,3,3,4,4,5,5,6,6-dodecadeuteriohexane. InChIKey: SGRHVVLXEBNBDV-LBTWDOQPSA-N.
| Molecular formula | C6H12Br2 |
|---|---|
| Molecular weight | 256.04 g/mol |
| IUPAC name | 1,6-dibromo-1,1,2,2,3,3,4,4,5,5,6,6-dodecadeuteriohexane |
| InChIKey | SGRHVVLXEBNBDV-LBTWDOQPSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])C([2H])([2H])C([2H])([2H])Br)C([2H])([2H])C([2H])([2H])Br |
Computed by PubChem (NCBI)