CAS 16941-11-0 appears in our catalog under these names: Ammonium hexafluorophosphate, 97%, Ammonium hexafluorophosphate, 99%, Ammonium Hexafluorophosphate, Ammonium hexafluorophosphate, 99%, Ammonium hexafluorophosphate/ 99+%. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Chemat. Available pack sizes: 100g, 1kg, 25g, 500g, 5g, on request, 1g.
Azanium hexafluorophosphate (CAS 16941-11-0) is a chemical compound with the molecular formula F6H4NP and a molecular weight of 163.003 g/mol. IUPAC name: azanium hexafluorophosphate. InChIKey: NIZXKAYXSNUDOU-UHFFFAOYSA-O.
| Molecular formula | F6H4NP |
|---|---|
| Molecular weight | 163.003 g/mol |
| IUPAC name | azanium hexafluorophosphate |
| InChIKey | NIZXKAYXSNUDOU-UHFFFAOYSA-O |
| SMILES | [NH4+].F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)