CAS 16941-12-1 appears in our catalog under these names: Dihydrogen hexachloroplatinate(IV), solution, Chloroplatinic acid, 90%, Dihydrogen hexachloroplatinate(IV) solution, Pt 20% (cont. P, Dihydrogen hexachloroplatinate(IV) solution, Pt 20% (cont. Pt) , CHLOROPLATINIC ACID SOLUTION 8 WT. % I&. Offered by: Chemat, Combi-blocks, Thermo Scientific (Alfa Aesar), Sigma-Aldrich. Available pack sizes: 1g, 5g, 25g, (c)2g, (c)10g, (c)0.5g, 10ML, 250ML.
Hexachloroplatinum(2-);hydron (CAS 16941-12-1) is a chemical compound with the molecular formula Cl6H2Pt and a molecular weight of 409.8 g/mol. IUPAC name: hexachloroplatinum(2-);hydron. InChIKey: GBFHNZZOZWQQPA-UHFFFAOYSA-J.
| Molecular formula | Cl6H2Pt |
|---|---|
| Molecular weight | 409.8 g/mol |
| IUPAC name | hexachloroplatinum(2-);hydron |
| InChIKey | GBFHNZZOZWQQPA-UHFFFAOYSA-J |
| SMILES | [H+].[H+].Cl[Pt-2](Cl)(Cl)(Cl)(Cl)Cl |
Computed by PubChem (NCBI)