Products 16941-15-4
CAS 16941-15-4 is the registry number for Pyridinium hexafluorophosphate, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 5g, 250mg, 1g, 10g, 25g.
Pyridin-1-ium hexafluorophosphate (CAS 16941-15-4) is a chemical compound with the molecular formula C5H6F6NP and a molecular weight of 225.07 g/mol. IUPAC name: pyridin-1-ium hexafluorophosphate. InChIKey: LWZCEHOZEYVSRX-UHFFFAOYSA-O.
| Molecular formula | C5H6F6NP |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | pyridin-1-ium hexafluorophosphate |
| InChIKey | LWZCEHOZEYVSRX-UHFFFAOYSA-O |
| SMILES | C1=CC=[NH+]C=C1.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)