Products 1694516-01-2
CAS 1694516-01-2 is the registry number for 1-(3-bromo-2-fluorophenyl)-2,2-dimethylpropan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-bromo-2-fluorophenyl)-2,2-dimethylpropan-1-ol (CAS 1694516-01-2) is a chemical compound with the molecular formula C11H14BrFO and a molecular weight of 261.13 g/mol. IUPAC name: 1-(3-bromo-2-fluorophenyl)-2,2-dimethylpropan-1-ol. InChIKey: SRMAGTZQLNLKKC-UHFFFAOYSA-N.
| Molecular formula | C11H14BrFO |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | 1-(3-bromo-2-fluorophenyl)-2,2-dimethylpropan-1-ol |
| InChIKey | SRMAGTZQLNLKKC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=C(C(=CC=C1)Br)F)O |
Computed by PubChem (NCBI)