CAS 16954-74-8 appears in our catalog under these names: 2-(Dicyanomethylene)indan-1,3-dione, 95%, 2-(1,3-Dioxo-1H-inden-2(3H)-ylidene)malononitrile, 98+%, 2-(Dicyanomethylene)indan-1,3-dione, 2-(Dicyanomethylene)indan-1,3-dione, >98.0%(HPLC)(N), 2-(1,3-Dioxo-1H-inden-2(3H)-ylidene)malononitrile. Offered by: Combi-blocks, AmBeed, Biosynth, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
2-(1,3-dioxoinden-2-ylidene)propanedinitrile (CAS 16954-74-8) is a chemical compound with the molecular formula C12H4N2O2 and a molecular weight of 208.17 g/mol. IUPAC name: 2-(1,3-dioxoinden-2-ylidene)propanedinitrile. InChIKey: WQFLMIPTYDGFOB-UHFFFAOYSA-N.
| Molecular formula | C12H4N2O2 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 2-(1,3-dioxoinden-2-ylidene)propanedinitrile |
| InChIKey | WQFLMIPTYDGFOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=C(C#N)C#N)C2=O |
Computed by PubChem (NCBI)