CAS 169545-27-1 appears in our catalog under these names: Irl-2500, 95%, IRL 2500/ 98.29% (existing batch purity), IRL–2500, IRL-2500, IRL 2500 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 50 mg, 5 mg.
(2S)-2-[[(2R)-2-[(3,5-dimethylbenzoyl)-methylamino]-3-(4-phenylphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (CAS 169545-27-1) is a chemical compound with the molecular formula C36H35N3O4 and a molecular weight of 573.7 g/mol. IUPAC name: (2S)-2-[[(2R)-2-[(3,5-dimethylbenzoyl)-methylamino]-3-(4-phenylphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid. InChIKey: UZDORQWMYRRLQV-JHOUSYSJSA-N.
| Molecular formula | C36H35N3O4 |
|---|---|
| Molecular weight | 573.7 g/mol |
| IUPAC name | (2S)-2-[[(2R)-2-[(3,5-dimethylbenzoyl)-methylamino]-3-(4-phenylphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | UZDORQWMYRRLQV-JHOUSYSJSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)N(C)[C@H](CC2=CC=C(C=C2)C3=CC=CC=C3)C(=O)N[C@@H](CC4=CNC5=CC=CC=C54)C(=O)O)C |
Computed by PubChem (NCBI)