CAS 1695936-82-3 appears in our catalog under these names: 4-Bromo-3,6-difluoro-2-iodoaniline, 98%, 4-BROMO-3,6-DIFLUORO-2-IODOANILINE, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 250mg, 100mg, 500mg, 1g.
4-bromo-3,6-difluoro-2-iodoaniline (CAS 1695936-82-3) is a chemical compound with the molecular formula C6H3BrF2IN and a molecular weight of 333.90 g/mol. IUPAC name: 4-bromo-3,6-difluoro-2-iodoaniline. InChIKey: RFJWYXNDUAVDKY-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF2IN |
|---|---|
| Molecular weight | 333.90 g/mol |
| IUPAC name | 4-bromo-3,6-difluoro-2-iodoaniline |
| InChIKey | RFJWYXNDUAVDKY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)I)N)F |
Computed by PubChem (NCBI)